C25H31N3O4 — CID 123680159
[4-[1-acetyl-6-(hexanoylamino)-4-methyl-2,3-dihydroquinolin-4-yl]phenyl]carbamic acid (PubChem CID 123680159) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is [4-[1-acetyl-6-(hexanoylamino)-4-methyl-2,3-dihydroquinolin-4-yl]phenyl]carbamic acid.
| Compound Name | [4-[1-acetyl-6-(hexanoylamino)-4-methyl-2,3-dihydroquinolin-4-yl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 123680159 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | [4-[1-acetyl-6-(hexanoylamino)-4-methyl-2,3-dihydroquinolin-4-yl]phenyl]carbamic acid |
| SMILES | CCCCCC(=O)Nc1ccc2c(c1)C(C)(c1ccc(NC(=O)O)cc1)CCN2C(C)=O |
| InChI | InChI=1S/C25H31N3O4/c1-4-5-6-7-23(30)26-20-12-13-22-21(16-20)25(3,14-15-28(22)17(2)29)18-8-10-19(11-9-18)27-24(31)32/h8-13,16,27H,4-7,14-15H2,1-3H3,(H,26,30)(H,31,32) |
| InChIKey | MMFNNLTZJXTYAF-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|