About 1-hydroxy-9-N-methylpurin-1-ium-6,9-diamine
1-hydroxy-9-N-methylpurin-1-ium-6,9-diamine (PubChem CID 123680816) has the molecular formula C6H9N6O+
and a molecular weight of 181.18 g/mol. Its IUPAC name is 1-hydroxy-9-N-methylpurin-1-ium-6,9-diamine.
Molecular Properties
| Compound Name | 1-hydroxy-9-N-methylpurin-1-ium-6,9-diamine |
| PubChem CID | 123680816 |
| Molecular Formula | C6H9N6O+ |
| Molecular Weight | 181.18 g/mol |
| Exact Mass | 181.08 |
| IUPAC Name | 1-hydroxy-9-N-methylpurin-1-ium-6,9-diamine |
| SMILES | CNn1cnc2c(N)[n+](O)cnc21 |
| InChI | InChI=1S/C6H8N6O/c1-8-11-2-9-4-5(7)12(13)3-10-6(4)11/h2-3,7-8,13H,1H3/p+1 |
| InChIKey | MLZCALDDCPMLOY-UHFFFAOYSA-O |
| XLogP | -1.29 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.18 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-9-N-methylpurin-1-ium-6,9-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-9-N-methylpurin-1-ium-6,9-diamine?
The IUPAC name of 1-hydroxy-9-N-methylpurin-1-ium-6,9-diamine (CID 123680816) is 1-hydroxy-9-N-methylpurin-1-ium-6,9-diamine.
What is the SMILES notation for 1-hydroxy-9-N-methylpurin-1-ium-6,9-diamine?
The canonical SMILES for 1-hydroxy-9-N-methylpurin-1-ium-6,9-diamine is CNn1cnc2c(N)[n+](O)cnc21.
What is the InChIKey of 1-hydroxy-9-N-methylpurin-1-ium-6,9-diamine?
The InChIKey is MLZCALDDCPMLOY-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H8N6O/c1-8-11-2-9-4-5(7)12(13)3-10-6(4)11/h2-3,7-8,13H,1H3/p+1.
What are the key properties of 1-hydroxy-9-N-methylpurin-1-ium-6,9-diamine?
1-hydroxy-9-N-methylpurin-1-ium-6,9-diamine has a molecular weight of 181.18 g/mol, XLogP of -1.29, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-9-N-methylpurin-1-ium-6,9-diamine is sourced from PubChem (CID 123680816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).