About pyrimidin-4-yl 5-[2-(3,5-diethyl-4-hydroxyphenyl)ethyl]-1,3-thiazole-2-carboxylate
pyrimidin-4-yl 5-[2-(3,5-diethyl-4-hydroxyphenyl)ethyl]-1,3-thiazole-2-carboxylate (PubChem CID 123680895) has the molecular formula C20H21N3O3S
and a molecular weight of 383.47 g/mol. Its IUPAC name is pyrimidin-4-yl 5-[2-(3,5-diethyl-4-hydroxyphenyl)ethyl]-1,3-thiazole-2-carboxylate.
Molecular Properties
| Compound Name | pyrimidin-4-yl 5-[2-(3,5-diethyl-4-hydroxyphenyl)ethyl]-1,3-thiazole-2-carboxylate |
| PubChem CID | 123680895 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | pyrimidin-4-yl 5-[2-(3,5-diethyl-4-hydroxyphenyl)ethyl]-1,3-thiazole-2-carboxylate |
| SMILES | CCc1cc(CCc2cnc(C(=O)Oc3ccncn3)s2)cc(CC)c1O |
| InChI | InChI=1S/C20H21N3O3S/c1-3-14-9-13(10-15(4-2)18(14)24)5-6-16-11-22-19(27-16)20(25)26-17-7-8-21-12-23-17/h7-12,24H,3-6H2,1-2H3 |
| InChIKey | NZJDLUAHFJSHPX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 85.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze pyrimidin-4-yl 5-[2-(3,5-diethyl-4-hydroxyphenyl)ethyl]-1,3-thiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrimidin-4-yl 5-[2-(3,5-diethyl-4-hydroxyphenyl)ethyl]-1,3-thiazole-2-carboxylate?
The IUPAC name of pyrimidin-4-yl 5-[2-(3,5-diethyl-4-hydroxyphenyl)ethyl]-1,3-thiazole-2-carboxylate (CID 123680895) is pyrimidin-4-yl 5-[2-(3,5-diethyl-4-hydroxyphenyl)ethyl]-1,3-thiazole-2-carboxylate.
What is the SMILES notation for pyrimidin-4-yl 5-[2-(3,5-diethyl-4-hydroxyphenyl)ethyl]-1,3-thiazole-2-carboxylate?
The canonical SMILES for pyrimidin-4-yl 5-[2-(3,5-diethyl-4-hydroxyphenyl)ethyl]-1,3-thiazole-2-carboxylate is CCc1cc(CCc2cnc(C(=O)Oc3ccncn3)s2)cc(CC)c1O.
What is the InChIKey of pyrimidin-4-yl 5-[2-(3,5-diethyl-4-hydroxyphenyl)ethyl]-1,3-thiazole-2-carboxylate?
The InChIKey is NZJDLUAHFJSHPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O3S/c1-3-14-9-13(10-15(4-2)18(14)24)5-6-16-11-22-19(27-16)20(25)26-17-7-8-21-12-23-17/h7-12,24H,3-6H2,1-2H3.
What are the key properties of pyrimidin-4-yl 5-[2-(3,5-diethyl-4-hydroxyphenyl)ethyl]-1,3-thiazole-2-carboxylate?
pyrimidin-4-yl 5-[2-(3,5-diethyl-4-hydroxyphenyl)ethyl]-1,3-thiazole-2-carboxylate has a molecular weight of 383.47 g/mol, XLogP of 3.77, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for pyrimidin-4-yl 5-[2-(3,5-diethyl-4-hydroxyphenyl)ethyl]-1,3-thiazole-2-carboxylate is sourced from PubChem (CID 123680895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).