About 4-bromo-N-(2-methoxyethyl)-N-methylhexa-2,4-dien-2-amine
4-bromo-N-(2-methoxyethyl)-N-methylhexa-2,4-dien-2-amine (PubChem CID 123680902) has the molecular formula C10H18BrNO
and a molecular weight of 248.16 g/mol. Its IUPAC name is 4-bromo-N-(2-methoxyethyl)-N-methylhexa-2,4-dien-2-amine.
Molecular Properties
| Compound Name | 4-bromo-N-(2-methoxyethyl)-N-methylhexa-2,4-dien-2-amine |
| PubChem CID | 123680902 |
| Molecular Formula | C10H18BrNO |
| Molecular Weight | 248.16 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 4-bromo-N-(2-methoxyethyl)-N-methylhexa-2,4-dien-2-amine |
| SMILES | CC=C(Br)C=C(C)N(C)CCOC |
| InChI | InChI=1S/C10H18BrNO/c1-5-10(11)8-9(2)12(3)6-7-13-4/h5,8H,6-7H2,1-4H3 |
| InChIKey | XMONDJLZOHCFSW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.16 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-N-(2-methoxyethyl)-N-methylhexa-2,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-(2-methoxyethyl)-N-methylhexa-2,4-dien-2-amine?
The IUPAC name of 4-bromo-N-(2-methoxyethyl)-N-methylhexa-2,4-dien-2-amine (CID 123680902) is 4-bromo-N-(2-methoxyethyl)-N-methylhexa-2,4-dien-2-amine.
What is the SMILES notation for 4-bromo-N-(2-methoxyethyl)-N-methylhexa-2,4-dien-2-amine?
The canonical SMILES for 4-bromo-N-(2-methoxyethyl)-N-methylhexa-2,4-dien-2-amine is CC=C(Br)C=C(C)N(C)CCOC.
What is the InChIKey of 4-bromo-N-(2-methoxyethyl)-N-methylhexa-2,4-dien-2-amine?
The InChIKey is XMONDJLZOHCFSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18BrNO/c1-5-10(11)8-9(2)12(3)6-7-13-4/h5,8H,6-7H2,1-4H3.
What are the key properties of 4-bromo-N-(2-methoxyethyl)-N-methylhexa-2,4-dien-2-amine?
4-bromo-N-(2-methoxyethyl)-N-methylhexa-2,4-dien-2-amine has a molecular weight of 248.16 g/mol, XLogP of 2.77, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-(2-methoxyethyl)-N-methylhexa-2,4-dien-2-amine is sourced from PubChem (CID 123680902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).