C14H17F3O7S — CID 123681124
1,1,2-trifluoro-3-(2,2,3-trimethyl-8-oxo-7-oxatricyclo[4.2.0.01,3]octane-6-carbonyl)oxypropane-1-sulfonic acid (PubChem CID 123681124) has the molecular formula C14H17F3O7S and a molecular weight of 386.34 g/mol. Its IUPAC name is 1,1,2-trifluoro-3-(2,2,3-trimethyl-8-oxo-7-oxatricyclo[4.2.0.01,3]octane-6-carbonyl)oxypropane-1-sulfonic acid.
| Compound Name | 1,1,2-trifluoro-3-(2,2,3-trimethyl-8-oxo-7-oxatricyclo[4.2.0.01,3]octane-6-carbonyl)oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 123681124 |
| Molecular Formula | C14H17F3O7S |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 1,1,2-trifluoro-3-(2,2,3-trimethyl-8-oxo-7-oxatricyclo[4.2.0.01,3]octane-6-carbonyl)oxypropane-1-sulfonic acid |
| SMILES | CC1(C)C2(C)CCC3(C(=O)OCC(F)C(F)(F)S(=O)(=O)O)OC(=O)C312 |
| InChI | InChI=1S/C14H17F3O7S/c1-10(2)11(3)4-5-12(13(10,11)9(19)24-12)8(18)23-6-7(15)14(16,17)25(20,21)22/h7H,4-6H2,1-3H3,(H,20,21,22) |
| InChIKey | HTAUSJFUZMCQJP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|