C15H15NO2 — CID 123681261
(E)-7-(5-methyl-1-azacyclohepta-1,3,5,6-tetraen-2-yl)-3-methylidenehept-6-ene-2,4-dione (PubChem CID 123681261) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is (E)-7-(5-methyl-1-azacyclohepta-1,3,5,6-tetraen-2-yl)-3-methylidenehept-6-ene-2,4-dione.
| Compound Name | (E)-7-(5-methyl-1-azacyclohepta-1,3,5,6-tetraen-2-yl)-3-methylidenehept-6-ene-2,4-dione |
|---|---|
| PubChem CID | 123681261 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | (E)-7-(5-methyl-1-azacyclohepta-1,3,5,6-tetraen-2-yl)-3-methylidenehept-6-ene-2,4-dione |
| SMILES | C=C(C(C)=O)C(=O)C/C=C/C1=NC=C=C(C)C=C1 |
| InChI | InChI=1S/C15H15NO2/c1-11-7-8-14(16-10-9-11)5-4-6-15(18)12(2)13(3)17/h4-5,7-8,10H,2,6H2,1,3H3/b5-4+ |
| InChIKey | CAVPINLBHLDZSK-SNAWJCMRSA-N |
| XLogP | 2.72 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|