C22H27N7O — CID 123681740
5-[methyl-[2-(methylamino)cyclohexyl]amino]-3-(quinolin-5-ylamino)pyrazine-2-carboxamide (PubChem CID 123681740) has the molecular formula C22H27N7O and a molecular weight of 405.51 g/mol. Its IUPAC name is 5-[methyl-[2-(methylamino)cyclohexyl]amino]-3-(quinolin-5-ylamino)pyrazine-2-carboxamide.
| Compound Name | 5-[methyl-[2-(methylamino)cyclohexyl]amino]-3-(quinolin-5-ylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 123681740 |
| Molecular Formula | C22H27N7O |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 5-[methyl-[2-(methylamino)cyclohexyl]amino]-3-(quinolin-5-ylamino)pyrazine-2-carboxamide |
| SMILES | CNC1CCCCC1N(C)c1cnc(C(N)=O)c(Nc2cccc3ncccc23)n1 |
| InChI | InChI=1S/C22H27N7O/c1-24-17-8-3-4-11-18(17)29(2)19-13-26-20(21(23)30)22(28-19)27-16-10-5-9-15-14(16)7-6-12-25-15/h5-7,9-10,12-13,17-18,24H,3-4,8,11H2,1-2H3,(H2,23,30)(H,27,28) |
| InChIKey | VLSPQLMOACCFCO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |