C26H39F2NO2S — CID 123682050
3-(2,4-difluorophenyl)-N-(2,4-dimethylpentyl)-N-(4-ethyl-2-hydroxy-6-methyl-3-sulfanylideneheptan-4-yl)prop-2-enamide (PubChem CID 123682050) has the molecular formula C26H39F2NO2S and a molecular weight of 467.67 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-N-(2,4-dimethylpentyl)-N-(4-ethyl-2-hydroxy-6-methyl-3-sulfanylideneheptan-4-yl)prop-2-enamide.
| Compound Name | 3-(2,4-difluorophenyl)-N-(2,4-dimethylpentyl)-N-(4-ethyl-2-hydroxy-6-methyl-3-sulfanylideneheptan-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 123682050 |
| Molecular Formula | C26H39F2NO2S |
| Molecular Weight | 467.67 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | 3-(2,4-difluorophenyl)-N-(2,4-dimethylpentyl)-N-(4-ethyl-2-hydroxy-6-methyl-3-sulfanylideneheptan-4-yl)prop-2-enamide |
| SMILES | CCC(CC(C)C)(C(=S)C(C)O)N(CC(C)CC(C)C)C(=O)C=Cc1ccc(F)cc1F |
| InChI | InChI=1S/C26H39F2NO2S/c1-8-26(15-18(4)5,25(32)20(7)30)29(16-19(6)13-17(2)3)24(31)12-10-21-9-11-22(27)14-23(21)28/h9-12,14,17-20,30H,8,13,15-16H2,1-7H3 |
| InChIKey | AHMVHGKXRCDPPC-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.67 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|