C30H34FNO6 — CID 123682078
4-[(4-fluoro-1,2-benzoxazol-3-yl)oxy]-5-hydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-19-one (PubChem CID 123682078) has the molecular formula C30H34FNO6 and a molecular weight of 523.60 g/mol. Its IUPAC name is 4-[(4-fluoro-1,2-benzoxazol-3-yl)oxy]-5-hydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-19-one.
| Compound Name | 4-[(4-fluoro-1,2-benzoxazol-3-yl)oxy]-5-hydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-19-one |
|---|---|
| PubChem CID | 123682078 |
| Molecular Formula | C30H34FNO6 |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | 4-[(4-fluoro-1,2-benzoxazol-3-yl)oxy]-5-hydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-19-one |
| SMILES | CC1=CC23C(=O)C(C=C4COC(C)(C)OC4C2(O)C1Oc1noc2cccc(F)c12)C1C(CC3C)C1(C)C |
| InChI | InChI=1S/C30H34FNO6/c1-14-12-29-15(2)10-18-22(27(18,3)4)17(23(29)33)11-16-13-35-28(5,6)37-25(16)30(29,34)24(14)36-26-21-19(31)8-7-9-20(21)38-32-26/h7-9,11-12,15,17-18,22,24-25,34H,10,13H2,1-6H3 |
| InChIKey | VAVSIXQJRYXOEM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 91.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|