C30H37FN4O — CID 123682487
N-[N-tert-butyl-N'-[2,3-diethyl-6-(4-fluorophenyl)cyclohept-3-en-1-yl]carbamimidoyl]-3-cyanobenzamide (PubChem CID 123682487) has the molecular formula C30H37FN4O and a molecular weight of 488.65 g/mol. Its IUPAC name is N-[N-tert-butyl-N'-[2,3-diethyl-6-(4-fluorophenyl)cyclohept-3-en-1-yl]carbamimidoyl]-3-cyanobenzamide.
| Compound Name | N-[N-tert-butyl-N'-[2,3-diethyl-6-(4-fluorophenyl)cyclohept-3-en-1-yl]carbamimidoyl]-3-cyanobenzamide |
|---|---|
| PubChem CID | 123682487 |
| Molecular Formula | C30H37FN4O |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | N-[N-tert-butyl-N'-[2,3-diethyl-6-(4-fluorophenyl)cyclohept-3-en-1-yl]carbamimidoyl]-3-cyanobenzamide |
| SMILES | CCC1=CCC(c2ccc(F)cc2)CC(/N=C(\NC(=O)c2cccc(C#N)c2)NC(C)(C)C)C1CC |
| InChI | InChI=1S/C30H37FN4O/c1-6-21-11-12-23(22-13-15-25(31)16-14-22)18-27(26(21)7-2)33-29(35-30(3,4)5)34-28(36)24-10-8-9-20(17-24)19-32/h8-11,13-17,23,26-27H,6-7,12,18H2,1-5H3,(H2,33,34,35,36) |
| InChIKey | NSCCTWMSNGKBTN-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 77.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|