C8H9N3O2S — CID 123682913
methyl 3,4-dihydropyrazino[2,1-c][1,2,4]thiadiazine-9-carboxylate (PubChem CID 123682913) has the molecular formula C8H9N3O2S and a molecular weight of 211.25 g/mol. Its IUPAC name is methyl 3,4-dihydropyrazino[2,1-c][1,2,4]thiadiazine-9-carboxylate.
| Compound Name | methyl 3,4-dihydropyrazino[2,1-c][1,2,4]thiadiazine-9-carboxylate |
|---|---|
| PubChem CID | 123682913 |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | methyl 3,4-dihydropyrazino[2,1-c][1,2,4]thiadiazine-9-carboxylate |
| SMILES | COC(=O)C1=NC=CN2CCSN=C12 |
| InChI | InChI=1S/C8H9N3O2S/c1-13-8(12)6-7-10-14-5-4-11(7)3-2-9-6/h2-3H,4-5H2,1H3 |
| InChIKey | DMUKNQJEHZLFAE-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|