C17H29BN2O5 — CID 123683421
ethyl 2-(oxan-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole-5-carboxylate (PubChem CID 123683421) has the molecular formula C17H29BN2O5 and a molecular weight of 352.24 g/mol. Its IUPAC name is ethyl 2-(oxan-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole-5-carboxylate.
| Compound Name | ethyl 2-(oxan-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 123683421 |
| Molecular Formula | C17H29BN2O5 |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | ethyl 2-(oxan-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole-5-carboxylate |
| SMILES | CCOC(=O)C1C=C(B2OC(C)(C)C(C)(C)O2)N(C2CCCCO2)N1 |
| InChI | InChI=1S/C17H29BN2O5/c1-6-22-15(21)12-11-13(18-24-16(2,3)17(4,5)25-18)20(19-12)14-9-7-8-10-23-14/h11-12,14,19H,6-10H2,1-5H3 |
| InChIKey | MRESTERQVIUMOF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|