About (4E)-4-methyl-6-[[methyl(propyl)amino]methyl]hepta-4,6-dien-2-one
(4E)-4-methyl-6-[[methyl(propyl)amino]methyl]hepta-4,6-dien-2-one (PubChem CID 123683671) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is (4E)-4-methyl-6-[[methyl(propyl)amino]methyl]hepta-4,6-dien-2-one.
Molecular Properties
| Compound Name | (4E)-4-methyl-6-[[methyl(propyl)amino]methyl]hepta-4,6-dien-2-one |
| PubChem CID | 123683671 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (4E)-4-methyl-6-[[methyl(propyl)amino]methyl]hepta-4,6-dien-2-one |
| SMILES | C=C(/C=C(\C)CC(C)=O)CN(C)CCC |
| InChI | InChI=1S/C13H23NO/c1-6-7-14(5)10-12(3)8-11(2)9-13(4)15/h8H,3,6-7,9-10H2,1-2,4-5H3/b11-8+ |
| InChIKey | DPDLTYXOWWIWDX-DHZHZOJOSA-N |
| XLogP | 2.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-4-methyl-6-[[methyl(propyl)amino]methyl]hepta-4,6-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-methyl-6-[[methyl(propyl)amino]methyl]hepta-4,6-dien-2-one?
The IUPAC name of (4E)-4-methyl-6-[[methyl(propyl)amino]methyl]hepta-4,6-dien-2-one (CID 123683671) is (4E)-4-methyl-6-[[methyl(propyl)amino]methyl]hepta-4,6-dien-2-one.
What is the SMILES notation for (4E)-4-methyl-6-[[methyl(propyl)amino]methyl]hepta-4,6-dien-2-one?
The canonical SMILES for (4E)-4-methyl-6-[[methyl(propyl)amino]methyl]hepta-4,6-dien-2-one is C=C(/C=C(\C)CC(C)=O)CN(C)CCC.
What is the InChIKey of (4E)-4-methyl-6-[[methyl(propyl)amino]methyl]hepta-4,6-dien-2-one?
The InChIKey is DPDLTYXOWWIWDX-DHZHZOJOSA-N. The full InChI is InChI=1S/C13H23NO/c1-6-7-14(5)10-12(3)8-11(2)9-13(4)15/h8H,3,6-7,9-10H2,1-2,4-5H3/b11-8+.
What are the key properties of (4E)-4-methyl-6-[[methyl(propyl)amino]methyl]hepta-4,6-dien-2-one?
(4E)-4-methyl-6-[[methyl(propyl)amino]methyl]hepta-4,6-dien-2-one has a molecular weight of 209.33 g/mol, XLogP of 2.81, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-methyl-6-[[methyl(propyl)amino]methyl]hepta-4,6-dien-2-one is sourced from PubChem (CID 123683671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).