About N-(6-fluoro-4-methylideneocta-5,7-dienyl)ethanimine
N-(6-fluoro-4-methylideneocta-5,7-dienyl)ethanimine (PubChem CID 123683732) has the molecular formula C11H16FN
and a molecular weight of 181.25 g/mol. Its IUPAC name is N-(6-fluoro-4-methylideneocta-5,7-dienyl)ethanimine.
Molecular Properties
| Compound Name | N-(6-fluoro-4-methylideneocta-5,7-dienyl)ethanimine |
| PubChem CID | 123683732 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | N-(6-fluoro-4-methylideneocta-5,7-dienyl)ethanimine |
| SMILES | C=CC(F)=CC(=C)CCC/N=C/C |
| InChI | InChI=1S/C11H16FN/c1-4-11(12)9-10(3)7-6-8-13-5-2/h4-5,9H,1,3,6-8H2,2H3/b11-9?,13-5+ |
| InChIKey | GPNKSNNALSLGIZ-UIUHOFDNSA-N |
| XLogP | 3.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(6-fluoro-4-methylideneocta-5,7-dienyl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-fluoro-4-methylideneocta-5,7-dienyl)ethanimine?
The IUPAC name of N-(6-fluoro-4-methylideneocta-5,7-dienyl)ethanimine (CID 123683732) is N-(6-fluoro-4-methylideneocta-5,7-dienyl)ethanimine.
What is the SMILES notation for N-(6-fluoro-4-methylideneocta-5,7-dienyl)ethanimine?
The canonical SMILES for N-(6-fluoro-4-methylideneocta-5,7-dienyl)ethanimine is C=CC(F)=CC(=C)CCC/N=C/C.
What is the InChIKey of N-(6-fluoro-4-methylideneocta-5,7-dienyl)ethanimine?
The InChIKey is GPNKSNNALSLGIZ-UIUHOFDNSA-N. The full InChI is InChI=1S/C11H16FN/c1-4-11(12)9-10(3)7-6-8-13-5-2/h4-5,9H,1,3,6-8H2,2H3/b11-9?,13-5+.
What are the key properties of N-(6-fluoro-4-methylideneocta-5,7-dienyl)ethanimine?
N-(6-fluoro-4-methylideneocta-5,7-dienyl)ethanimine has a molecular weight of 181.25 g/mol, XLogP of 3.45, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-fluoro-4-methylideneocta-5,7-dienyl)ethanimine is sourced from PubChem (CID 123683732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).