C33H31Cl2F3N6O2 — CID 123684215
(E)-4-[3-[5-chloro-2-[[3-[[2,2,2-trifluoro-1-[4-(prop-2-enoylamino)phenyl]ethyl]amino]cyclohexyl]amino]pyrimidin-4-yl]-1H-indol-6-yl]but-3-enoyl chloride (PubChem CID 123684215) has the molecular formula C33H31Cl2F3N6O2 and a molecular weight of 671.55 g/mol. Its IUPAC name is (E)-4-[3-[5-chloro-2-[[3-[[2,2,2-trifluoro-1-[4-(prop-2-enoylamino)phenyl]ethyl]amino]cyclohexyl]amino]pyrimidin-4-yl]-1H-indol-6-yl]but-3-enoyl chloride.
| Compound Name | (E)-4-[3-[5-chloro-2-[[3-[[2,2,2-trifluoro-1-[4-(prop-2-enoylamino)phenyl]ethyl]amino]cyclohexyl]amino]pyrimidin-4-yl]-1H-indol-6-yl]but-3-enoyl chloride |
|---|---|
| PubChem CID | 123684215 |
| Molecular Formula | C33H31Cl2F3N6O2 |
| Molecular Weight | 671.55 g/mol |
| Exact Mass | 670.18 |
| IUPAC Name | (E)-4-[3-[5-chloro-2-[[3-[[2,2,2-trifluoro-1-[4-(prop-2-enoylamino)phenyl]ethyl]amino]cyclohexyl]amino]pyrimidin-4-yl]-1H-indol-6-yl]but-3-enoyl chloride |
| SMILES | C=CC(=O)Nc1ccc(C(NC2CCCC(Nc3ncc(Cl)c(-c4c[nH]c5cc(/C=C/CC(=O)Cl)ccc45)n3)C2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C33H31Cl2F3N6O2/c1-2-29(46)41-21-12-10-20(11-13-21)31(33(36,37)38)42-22-6-4-7-23(16-22)43-32-40-18-26(34)30(44-32)25-17-39-27-15-19(9-14-24(25)27)5-3-8-28(35)45/h2-3,5,9-15,17-18,22-23,31,39,42H,1,4,6-8,16H2,(H,41,46)(H,40,43,44)/b5-3+ |
| InChIKey | QHFHDHBHHJUUOY-HWKANZROSA-N |
| XLogP | 8.19 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.55 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|