About 5-buta-1,3-dien-2-yloxypyridine-3-carbonitrile
5-buta-1,3-dien-2-yloxypyridine-3-carbonitrile (PubChem CID 123684358) has the molecular formula C10H8N2O
and a molecular weight of 172.19 g/mol. Its IUPAC name is 5-buta-1,3-dien-2-yloxypyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 5-buta-1,3-dien-2-yloxypyridine-3-carbonitrile |
| PubChem CID | 123684358 |
| Molecular Formula | C10H8N2O |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 5-buta-1,3-dien-2-yloxypyridine-3-carbonitrile |
| SMILES | C=CC(=C)Oc1cncc(C#N)c1 |
| InChI | InChI=1S/C10H8N2O/c1-3-8(2)13-10-4-9(5-11)6-12-7-10/h3-4,6-7H,1-2H2 |
| InChIKey | JJKICPSADKIZTH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-buta-1,3-dien-2-yloxypyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-buta-1,3-dien-2-yloxypyridine-3-carbonitrile?
The IUPAC name of 5-buta-1,3-dien-2-yloxypyridine-3-carbonitrile (CID 123684358) is 5-buta-1,3-dien-2-yloxypyridine-3-carbonitrile.
What is the SMILES notation for 5-buta-1,3-dien-2-yloxypyridine-3-carbonitrile?
The canonical SMILES for 5-buta-1,3-dien-2-yloxypyridine-3-carbonitrile is C=CC(=C)Oc1cncc(C#N)c1.
What is the InChIKey of 5-buta-1,3-dien-2-yloxypyridine-3-carbonitrile?
The InChIKey is JJKICPSADKIZTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O/c1-3-8(2)13-10-4-9(5-11)6-12-7-10/h3-4,6-7H,1-2H2.
What are the key properties of 5-buta-1,3-dien-2-yloxypyridine-3-carbonitrile?
5-buta-1,3-dien-2-yloxypyridine-3-carbonitrile has a molecular weight of 172.19 g/mol, XLogP of 2.03, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-buta-1,3-dien-2-yloxypyridine-3-carbonitrile is sourced from PubChem (CID 123684358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).