About 2-(5-fluoro-4-methylhexa-2,4-dien-3-yl)oxyethanol
2-(5-fluoro-4-methylhexa-2,4-dien-3-yl)oxyethanol (PubChem CID 123684854) has the molecular formula C9H15FO2
and a molecular weight of 174.21 g/mol. Its IUPAC name is 2-(5-fluoro-4-methylhexa-2,4-dien-3-yl)oxyethanol.
Molecular Properties
| Compound Name | 2-(5-fluoro-4-methylhexa-2,4-dien-3-yl)oxyethanol |
| PubChem CID | 123684854 |
| Molecular Formula | C9H15FO2 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | 2-(5-fluoro-4-methylhexa-2,4-dien-3-yl)oxyethanol |
| SMILES | CC=C(OCCO)C(C)=C(C)F |
| InChI | InChI=1S/C9H15FO2/c1-4-9(12-6-5-11)7(2)8(3)10/h4,11H,5-6H2,1-3H3 |
| InChIKey | OEUDDUYQHSKIJE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-fluoro-4-methylhexa-2,4-dien-3-yl)oxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-fluoro-4-methylhexa-2,4-dien-3-yl)oxyethanol?
The IUPAC name of 2-(5-fluoro-4-methylhexa-2,4-dien-3-yl)oxyethanol (CID 123684854) is 2-(5-fluoro-4-methylhexa-2,4-dien-3-yl)oxyethanol.
What is the SMILES notation for 2-(5-fluoro-4-methylhexa-2,4-dien-3-yl)oxyethanol?
The canonical SMILES for 2-(5-fluoro-4-methylhexa-2,4-dien-3-yl)oxyethanol is CC=C(OCCO)C(C)=C(C)F.
What is the InChIKey of 2-(5-fluoro-4-methylhexa-2,4-dien-3-yl)oxyethanol?
The InChIKey is OEUDDUYQHSKIJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15FO2/c1-4-9(12-6-5-11)7(2)8(3)10/h4,11H,5-6H2,1-3H3.
What are the key properties of 2-(5-fluoro-4-methylhexa-2,4-dien-3-yl)oxyethanol?
2-(5-fluoro-4-methylhexa-2,4-dien-3-yl)oxyethanol has a molecular weight of 174.21 g/mol, XLogP of 2.16, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-fluoro-4-methylhexa-2,4-dien-3-yl)oxyethanol is sourced from PubChem (CID 123684854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).