About di(pyrazol-1-yl)silane
di(pyrazol-1-yl)silane (PubChem CID 123685072) has the molecular formula C6H8N4Si
and a molecular weight of 164.24 g/mol. Its IUPAC name is di(pyrazol-1-yl)silane.
Molecular Properties
| Compound Name | di(pyrazol-1-yl)silane |
| PubChem CID | 123685072 |
| Molecular Formula | C6H8N4Si |
| Molecular Weight | 164.24 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | di(pyrazol-1-yl)silane |
| SMILES | c1cnn([SiH2]n2cccn2)c1 |
| InChI | InChI=1S/C6H8N4Si/c1-3-7-9(5-1)11-10-6-2-4-8-10/h1-6H,11H2 |
| InChIKey | MJMBKLZSGKCWRU-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.24 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze di(pyrazol-1-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(pyrazol-1-yl)silane?
The IUPAC name of di(pyrazol-1-yl)silane (CID 123685072) is di(pyrazol-1-yl)silane.
What is the SMILES notation for di(pyrazol-1-yl)silane?
The canonical SMILES for di(pyrazol-1-yl)silane is c1cnn([SiH2]n2cccn2)c1.
What is the InChIKey of di(pyrazol-1-yl)silane?
The InChIKey is MJMBKLZSGKCWRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4Si/c1-3-7-9(5-1)11-10-6-2-4-8-10/h1-6H,11H2.
What are the key properties of di(pyrazol-1-yl)silane?
di(pyrazol-1-yl)silane has a molecular weight of 164.24 g/mol, XLogP of -0.53, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for di(pyrazol-1-yl)silane is sourced from PubChem (CID 123685072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).