C19H25NO4 — CID 123685254
tert-butyl 3-(3-ethoxy-3-oxoprop-1-enyl)-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 123685254) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is tert-butyl 3-(3-ethoxy-3-oxoprop-1-enyl)-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | tert-butyl 3-(3-ethoxy-3-oxoprop-1-enyl)-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 123685254 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | tert-butyl 3-(3-ethoxy-3-oxoprop-1-enyl)-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CCOC(=O)C=CC1Cc2ccccc2N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H25NO4/c1-5-23-17(21)11-10-14-12-15-8-6-7-9-16(15)20(13-14)18(22)24-19(2,3)4/h6-11,14H,5,12-13H2,1-4H3 |
| InChIKey | IVDAFEFSJIAEKU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|