C32H55N7O7 — CID 123686118
N-(2-amino-2-oxoethyl)-2-[[2-[[2-[[4-[3-(2-hydrazinylethoxy)-3-methylbutoxy]-4-methylpentanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanamide (PubChem CID 123686118) has the molecular formula C32H55N7O7 and a molecular weight of 649.83 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-2-[[2-[[2-[[4-[3-(2-hydrazinylethoxy)-3-methylbutoxy]-4-methylpentanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanamide.
| Compound Name | N-(2-amino-2-oxoethyl)-2-[[2-[[2-[[4-[3-(2-hydrazinylethoxy)-3-methylbutoxy]-4-methylpentanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 123686118 |
| Molecular Formula | C32H55N7O7 |
| Molecular Weight | 649.83 g/mol |
| Exact Mass | 649.42 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-2-[[2-[[2-[[4-[3-(2-hydrazinylethoxy)-3-methylbutoxy]-4-methylpentanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanamide |
| SMILES | CC(C)CC(NC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)CCC(C)(C)OCCC(C)(C)OCCNN)C(=O)NCC(N)=O |
| InChI | InChI=1S/C32H55N7O7/c1-22(2)18-24(29(43)36-20-26(33)40)39-30(44)25(19-23-10-8-7-9-11-23)38-28(42)21-35-27(41)12-13-31(3,4)45-16-14-32(5,6)46-17-15-37-34/h7-11,22,24-25,37H,12-21,34H2,1-6H3,(H2,33,40)(H,35,41)(H,36,43)(H,38,42)(H,39,44) |
| InChIKey | VLKCAEMGNFFAJU-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 216.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.83 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|