C43H27F5N3P — CID 123686310
[5-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]-4,5-diphenylimidazol-2-yl]quinolin-6-yl]-diphenylphosphane (PubChem CID 123686310) has the molecular formula C43H27F5N3P and a molecular weight of 711.67 g/mol. Its IUPAC name is [5-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]-4,5-diphenylimidazol-2-yl]quinolin-6-yl]-diphenylphosphane.
| Compound Name | [5-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]-4,5-diphenylimidazol-2-yl]quinolin-6-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 123686310 |
| Molecular Formula | C43H27F5N3P |
| Molecular Weight | 711.67 g/mol |
| Exact Mass | 711.19 |
| IUPAC Name | [5-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]-4,5-diphenylimidazol-2-yl]quinolin-6-yl]-diphenylphosphane |
| SMILES | Fc1c(F)c(F)c(Cn2c(-c3c(P(c4ccccc4)c4ccccc4)ccc4ncccc34)nc(-c3ccccc3)c2-c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C43H27F5N3P/c44-36-32(37(45)39(47)40(48)38(36)46)26-51-42(28-16-7-2-8-17-28)41(27-14-5-1-6-15-27)50-43(51)35-31-22-13-25-49-33(31)23-24-34(35)52(29-18-9-3-10-19-29)30-20-11-4-12-21-30/h1-25H,26H2 |
| InChIKey | FHYXDOPENIVHFI-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.67 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|