C14H15F3N6O2 — CID 123686404
3-[[2-(azetidin-3-ylamino)-2-oxoethyl]amino]-5-(trifluoromethyl)indazole-1-carboxamide (PubChem CID 123686404) has the molecular formula C14H15F3N6O2 and a molecular weight of 356.31 g/mol. Its IUPAC name is 3-[[2-(azetidin-3-ylamino)-2-oxoethyl]amino]-5-(trifluoromethyl)indazole-1-carboxamide.
| Compound Name | 3-[[2-(azetidin-3-ylamino)-2-oxoethyl]amino]-5-(trifluoromethyl)indazole-1-carboxamide |
|---|---|
| PubChem CID | 123686404 |
| Molecular Formula | C14H15F3N6O2 |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 3-[[2-(azetidin-3-ylamino)-2-oxoethyl]amino]-5-(trifluoromethyl)indazole-1-carboxamide |
| SMILES | NC(=O)n1nc(NCC(=O)NC2CNC2)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C14H15F3N6O2/c15-14(16,17)7-1-2-10-9(3-7)12(22-23(10)13(18)25)20-6-11(24)21-8-4-19-5-8/h1-3,8,19H,4-6H2,(H2,18,25)(H,20,22)(H,21,24) |
| InChIKey | XPWKNWTYRKGUCA-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 114.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |