C15H21FN2 — CID 123686606
(2Z,7E)-5-fluoro-2-methyl-4-N-(3-methylbutan-2-yl)cyclonona-2,5,7-triene-1,4-diimine (PubChem CID 123686606) has the molecular formula C15H21FN2 and a molecular weight of 248.34 g/mol. Its IUPAC name is (2Z,7E)-5-fluoro-2-methyl-4-N-(3-methylbutan-2-yl)cyclonona-2,5,7-triene-1,4-diimine.
| Compound Name | (2Z,7E)-5-fluoro-2-methyl-4-N-(3-methylbutan-2-yl)cyclonona-2,5,7-triene-1,4-diimine |
|---|---|
| PubChem CID | 123686606 |
| Molecular Formula | C15H21FN2 |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | (2Z,7E)-5-fluoro-2-methyl-4-N-(3-methylbutan-2-yl)cyclonona-2,5,7-triene-1,4-diimine |
| SMILES | [H]/N=C1C/C=C/C=C(F)C(=N\C(C)C(C)C)\C=C\1C |
| InChI | InChI=1S/C15H21FN2/c1-10(2)12(4)18-15-9-11(3)14(17)8-6-5-7-13(15)16/h5-7,9-10,12,17H,8H2,1-4H3/b6-5+,11-9+,13-7?,17-14+,18-15- |
| InChIKey | CPPXEOHEBNGOSN-NMUZZUIHSA-N |
| XLogP | 4.25 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|