C12H17BrN5+ — CID 123686827
N-[(3-bromophenyl)methyl]-3-methyl-1-propyltetrazol-1-ium-5-amine (PubChem CID 123686827) has the molecular formula C12H17BrN5+ and a molecular weight of 311.21 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-3-methyl-1-propyltetrazol-1-ium-5-amine.
| Compound Name | N-[(3-bromophenyl)methyl]-3-methyl-1-propyltetrazol-1-ium-5-amine |
|---|---|
| PubChem CID | 123686827 |
| Molecular Formula | C12H17BrN5+ |
| Molecular Weight | 311.21 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-3-methyl-1-propyltetrazol-1-ium-5-amine |
| SMILES | CCC[n+]1nn(C)nc1NCc1cccc(Br)c1 |
| InChI | InChI=1S/C12H17BrN5/c1-3-7-18-12(15-17(2)16-18)14-9-10-5-4-6-11(13)8-10/h4-6,8H,3,7,9H2,1-2H3,(H,14,15,16)/q+1 |
| InChIKey | HGYILSFPBUUZKP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.21 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|