C10H13N3O — CID 123687188
1-(1,3-oxazol-4-ylmethyl)piperidine-3-carbonitrile (PubChem CID 123687188) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 1-(1,3-oxazol-4-ylmethyl)piperidine-3-carbonitrile.
| Compound Name | 1-(1,3-oxazol-4-ylmethyl)piperidine-3-carbonitrile |
|---|---|
| PubChem CID | 123687188 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 1-(1,3-oxazol-4-ylmethyl)piperidine-3-carbonitrile |
| SMILES | N#CC1CCCN(Cc2cocn2)C1 |
| InChI | InChI=1S/C10H13N3O/c11-4-9-2-1-3-13(5-9)6-10-7-14-8-12-10/h7-9H,1-3,5-6H2 |
| InChIKey | DUQCHCIJXRKYCA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 53.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |