C24H28N3O4+ — CID 123687617
CID 123687617 (PubChem CID 123687617) has the molecular formula C24H28N3O4+ and a molecular weight of 422.51 g/mol.
| Compound Name | CID 123687617 |
|---|---|
| PubChem CID | 123687617 |
| Molecular Formula | C24H28N3O4+ |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | — |
| SMILES | [H]/N=C(\N)c1cc(C2COC2)c(-c2cnc(OCC(C)(C)C(=O)OC)cc2C=C)cc1[CH2+] |
| InChI | InChI=1S/C24H28N3O4/c1-6-15-8-21(31-13-24(3,4)23(28)29-5)27-10-20(15)19-7-14(2)17(22(25)26)9-18(19)16-11-30-12-16/h6-10,16H,1-2,11-13H2,3-5H3,(H3,25,26)/q+1 |
| InChIKey | UMHPOFWGXXUKMZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|