C23H45NO2 — CID 123687812
N-(6-hydroxy-7,8-dimethylundec-10-en-5-yl)-3,4,5-trimethylheptanamide (PubChem CID 123687812) has the molecular formula C23H45NO2 and a molecular weight of 367.62 g/mol. Its IUPAC name is N-(6-hydroxy-7,8-dimethylundec-10-en-5-yl)-3,4,5-trimethylheptanamide.
| Compound Name | N-(6-hydroxy-7,8-dimethylundec-10-en-5-yl)-3,4,5-trimethylheptanamide |
|---|---|
| PubChem CID | 123687812 |
| Molecular Formula | C23H45NO2 |
| Molecular Weight | 367.62 g/mol |
| Exact Mass | 367.35 |
| IUPAC Name | N-(6-hydroxy-7,8-dimethylundec-10-en-5-yl)-3,4,5-trimethylheptanamide |
| SMILES | C=CCC(C)C(C)C(O)C(CCCC)NC(=O)CC(C)C(C)C(C)CC |
| InChI | InChI=1S/C23H45NO2/c1-9-12-14-21(23(26)20(8)17(5)13-10-2)24-22(25)15-18(6)19(7)16(4)11-3/h10,16-21,23,26H,2,9,11-15H2,1,3-8H3,(H,24,25) |
| InChIKey | FTFRUGGFTMWHJL-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.62 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|