About tert-butyl N-[1-(3-fluorohexa-2,4-dien-2-yl)piperidin-3-yl]carbamate
tert-butyl N-[1-(3-fluorohexa-2,4-dien-2-yl)piperidin-3-yl]carbamate (PubChem CID 123687869) has the molecular formula C16H27FN2O2
and a molecular weight of 298.40 g/mol. Its IUPAC name is tert-butyl N-[1-(3-fluorohexa-2,4-dien-2-yl)piperidin-3-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[1-(3-fluorohexa-2,4-dien-2-yl)piperidin-3-yl]carbamate |
| PubChem CID | 123687869 |
| Molecular Formula | C16H27FN2O2 |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | tert-butyl N-[1-(3-fluorohexa-2,4-dien-2-yl)piperidin-3-yl]carbamate |
| SMILES | CC=CC(F)=C(C)N1CCCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H27FN2O2/c1-6-8-14(17)12(2)19-10-7-9-13(11-19)18-15(20)21-16(3,4)5/h6,8,13H,7,9-11H2,1-5H3,(H,18,20) |
| InChIKey | HZQBKDCMODBAPO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[1-(3-fluorohexa-2,4-dien-2-yl)piperidin-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[1-(3-fluorohexa-2,4-dien-2-yl)piperidin-3-yl]carbamate?
The IUPAC name of tert-butyl N-[1-(3-fluorohexa-2,4-dien-2-yl)piperidin-3-yl]carbamate (CID 123687869) is tert-butyl N-[1-(3-fluorohexa-2,4-dien-2-yl)piperidin-3-yl]carbamate.
What is the SMILES notation for tert-butyl N-[1-(3-fluorohexa-2,4-dien-2-yl)piperidin-3-yl]carbamate?
The canonical SMILES for tert-butyl N-[1-(3-fluorohexa-2,4-dien-2-yl)piperidin-3-yl]carbamate is CC=CC(F)=C(C)N1CCCC(NC(=O)OC(C)(C)C)C1.
What is the InChIKey of tert-butyl N-[1-(3-fluorohexa-2,4-dien-2-yl)piperidin-3-yl]carbamate?
The InChIKey is HZQBKDCMODBAPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27FN2O2/c1-6-8-14(17)12(2)19-10-7-9-13(11-19)18-15(20)21-16(3,4)5/h6,8,13H,7,9-11H2,1-5H3,(H,18,20).
What are the key properties of tert-butyl N-[1-(3-fluorohexa-2,4-dien-2-yl)piperidin-3-yl]carbamate?
tert-butyl N-[1-(3-fluorohexa-2,4-dien-2-yl)piperidin-3-yl]carbamate has a molecular weight of 298.40 g/mol, XLogP of 3.75, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[1-(3-fluorohexa-2,4-dien-2-yl)piperidin-3-yl]carbamate is sourced from PubChem (CID 123687869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).