C24H38O5 — CID 123688278
(3E)-12-(2,5-dihydroxy-3,4-dimethoxy-6-methylcyclohex-3-en-1-yl)-2,6,10-trimethyldodeca-3,6,10-trienal (PubChem CID 123688278) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is (3E)-12-(2,5-dihydroxy-3,4-dimethoxy-6-methylcyclohex-3-en-1-yl)-2,6,10-trimethyldodeca-3,6,10-trienal.
| Compound Name | (3E)-12-(2,5-dihydroxy-3,4-dimethoxy-6-methylcyclohex-3-en-1-yl)-2,6,10-trimethyldodeca-3,6,10-trienal |
|---|---|
| PubChem CID | 123688278 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | (3E)-12-(2,5-dihydroxy-3,4-dimethoxy-6-methylcyclohex-3-en-1-yl)-2,6,10-trimethyldodeca-3,6,10-trienal |
| SMILES | COC1=C(OC)C(O)C(CC=C(C)CCC=C(C)C/C=C/C(C)C=O)C(C)C1O |
| InChI | InChI=1S/C24H38O5/c1-16(10-8-12-18(3)15-25)9-7-11-17(2)13-14-20-19(4)21(26)23(28-5)24(29-6)22(20)27/h8-9,12-13,15,18-22,26-27H,7,10-11,14H2,1-6H3/b12-8+,16-9?,17-13? |
| InChIKey | ZDYXGRAKPDADNI-CGKRLRJJSA-N |
| XLogP | 4.32 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|