C3H4BrN3O — CID 123688698
6-bromo-4,5-dihydro-2H-1,2,4-triazin-3-one (PubChem CID 123688698) has the molecular formula C3H4BrN3O and a molecular weight of 177.99 g/mol. Its IUPAC name is 6-bromo-4,5-dihydro-2H-1,2,4-triazin-3-one.
| Compound Name | 6-bromo-4,5-dihydro-2H-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 123688698 |
| Molecular Formula | C3H4BrN3O |
| Molecular Weight | 177.99 g/mol |
| Exact Mass | 176.95 |
| IUPAC Name | 6-bromo-4,5-dihydro-2H-1,2,4-triazin-3-one |
| SMILES | O=C1NCC(Br)=NN1 |
| InChI | InChI=1S/C3H4BrN3O/c4-2-1-5-3(8)7-6-2/h1H2,(H2,5,7,8) |
| InChIKey | FFXYSNLAWNXHSF-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.99 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |