About 5-methylcyclohepta-2,4-diene-1-thione
5-methylcyclohepta-2,4-diene-1-thione (PubChem CID 123689242) has the molecular formula C8H10S
and a molecular weight of 138.23 g/mol. Its IUPAC name is 5-methylcyclohepta-2,4-diene-1-thione.
Molecular Properties
| Compound Name | 5-methylcyclohepta-2,4-diene-1-thione |
| PubChem CID | 123689242 |
| Molecular Formula | C8H10S |
| Molecular Weight | 138.23 g/mol |
| Exact Mass | 138.05 |
| IUPAC Name | 5-methylcyclohepta-2,4-diene-1-thione |
| SMILES | CC1=CC=CC(=S)CC1 |
| InChI | InChI=1S/C8H10S/c1-7-3-2-4-8(9)6-5-7/h2-4H,5-6H2,1H3 |
| InChIKey | NZPOTKRADAYBAX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.23 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-methylcyclohepta-2,4-diene-1-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylcyclohepta-2,4-diene-1-thione?
The IUPAC name of 5-methylcyclohepta-2,4-diene-1-thione (CID 123689242) is 5-methylcyclohepta-2,4-diene-1-thione.
What is the SMILES notation for 5-methylcyclohepta-2,4-diene-1-thione?
The canonical SMILES for 5-methylcyclohepta-2,4-diene-1-thione is CC1=CC=CC(=S)CC1.
What is the InChIKey of 5-methylcyclohepta-2,4-diene-1-thione?
The InChIKey is NZPOTKRADAYBAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10S/c1-7-3-2-4-8(9)6-5-7/h2-4H,5-6H2,1H3.
What are the key properties of 5-methylcyclohepta-2,4-diene-1-thione?
5-methylcyclohepta-2,4-diene-1-thione has a molecular weight of 138.23 g/mol, XLogP of 2.65, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylcyclohepta-2,4-diene-1-thione is sourced from PubChem (CID 123689242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).