About (4-acetyl-1,2-oxazol-5-yl)-trimethylazanium
(4-acetyl-1,2-oxazol-5-yl)-trimethylazanium (PubChem CID 123689319) has the molecular formula C8H13N2O2+
and a molecular weight of 169.20 g/mol. Its IUPAC name is (4-acetyl-1,2-oxazol-5-yl)-trimethylazanium.
Molecular Properties
| Compound Name | (4-acetyl-1,2-oxazol-5-yl)-trimethylazanium |
| PubChem CID | 123689319 |
| Molecular Formula | C8H13N2O2+ |
| Molecular Weight | 169.20 g/mol |
| Exact Mass | 169.10 |
| IUPAC Name | (4-acetyl-1,2-oxazol-5-yl)-trimethylazanium |
| SMILES | CC(=O)c1cnoc1[N+](C)(C)C |
| InChI | InChI=1S/C8H13N2O2/c1-6(11)7-5-9-12-8(7)10(2,3)4/h5H,1-4H3/q+1 |
| InChIKey | CZKMFBFQTDMLHN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (4-acetyl-1,2-oxazol-5-yl)-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetyl-1,2-oxazol-5-yl)-trimethylazanium?
The IUPAC name of (4-acetyl-1,2-oxazol-5-yl)-trimethylazanium (CID 123689319) is (4-acetyl-1,2-oxazol-5-yl)-trimethylazanium.
What is the SMILES notation for (4-acetyl-1,2-oxazol-5-yl)-trimethylazanium?
The canonical SMILES for (4-acetyl-1,2-oxazol-5-yl)-trimethylazanium is CC(=O)c1cnoc1[N+](C)(C)C.
What is the InChIKey of (4-acetyl-1,2-oxazol-5-yl)-trimethylazanium?
The InChIKey is CZKMFBFQTDMLHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N2O2/c1-6(11)7-5-9-12-8(7)10(2,3)4/h5H,1-4H3/q+1.
What are the key properties of (4-acetyl-1,2-oxazol-5-yl)-trimethylazanium?
(4-acetyl-1,2-oxazol-5-yl)-trimethylazanium has a molecular weight of 169.20 g/mol, XLogP of 1.07, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetyl-1,2-oxazol-5-yl)-trimethylazanium is sourced from PubChem (CID 123689319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).