C16H24N2 — CID 123689422
2,4,6-trimethyl-3,4a,5,6,8,9,10,10b-octahydrobenzo[f]quinolin-7-imine (PubChem CID 123689422) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 2,4,6-trimethyl-3,4a,5,6,8,9,10,10b-octahydrobenzo[f]quinolin-7-imine.
| Compound Name | 2,4,6-trimethyl-3,4a,5,6,8,9,10,10b-octahydrobenzo[f]quinolin-7-imine |
|---|---|
| PubChem CID | 123689422 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 2,4,6-trimethyl-3,4a,5,6,8,9,10,10b-octahydrobenzo[f]quinolin-7-imine |
| SMILES | [H]/N=C1\CCCC2=C1C(C)CC1C2C=C(C)CN1C |
| InChI | InChI=1S/C16H24N2/c1-10-7-13-12-5-4-6-14(17)16(12)11(2)8-15(13)18(3)9-10/h7,11,13,15,17H,4-6,8-9H2,1-3H3/b17-14+ |
| InChIKey | GCTONOFHJPNCCP-SAPNQHFASA-N |
| XLogP | 3.40 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|