About 5-(4,5-dihydro-1H-pyrazol-3-yl)-1H-pyrazole
5-(4,5-dihydro-1H-pyrazol-3-yl)-1H-pyrazole (PubChem CID 123689515) has the molecular formula C6H8N4
and a molecular weight of 136.16 g/mol. Its IUPAC name is 5-(4,5-dihydro-1H-pyrazol-3-yl)-1H-pyrazole.
Molecular Properties
| Compound Name | 5-(4,5-dihydro-1H-pyrazol-3-yl)-1H-pyrazole |
| PubChem CID | 123689515 |
| Molecular Formula | C6H8N4 |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 5-(4,5-dihydro-1H-pyrazol-3-yl)-1H-pyrazole |
| SMILES | c1cc(C2=NNCC2)[nH]n1 |
| InChI | InChI=1S/C6H8N4/c1-3-7-9-5(1)6-2-4-8-10-6/h1,3,8H,2,4H2,(H,7,9) |
| InChIKey | YPVDIIRCFWAKHC-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4,5-dihydro-1H-pyrazol-3-yl)-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,5-dihydro-1H-pyrazol-3-yl)-1H-pyrazole?
The IUPAC name of 5-(4,5-dihydro-1H-pyrazol-3-yl)-1H-pyrazole (CID 123689515) is 5-(4,5-dihydro-1H-pyrazol-3-yl)-1H-pyrazole.
What is the SMILES notation for 5-(4,5-dihydro-1H-pyrazol-3-yl)-1H-pyrazole?
The canonical SMILES for 5-(4,5-dihydro-1H-pyrazol-3-yl)-1H-pyrazole is c1cc(C2=NNCC2)[nH]n1.
What is the InChIKey of 5-(4,5-dihydro-1H-pyrazol-3-yl)-1H-pyrazole?
The InChIKey is YPVDIIRCFWAKHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4/c1-3-7-9-5(1)6-2-4-8-10-6/h1,3,8H,2,4H2,(H,7,9).
What are the key properties of 5-(4,5-dihydro-1H-pyrazol-3-yl)-1H-pyrazole?
5-(4,5-dihydro-1H-pyrazol-3-yl)-1H-pyrazole has a molecular weight of 136.16 g/mol, XLogP of 0.11, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,5-dihydro-1H-pyrazol-3-yl)-1H-pyrazole is sourced from PubChem (CID 123689515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).