About 2-(2-methoxyphenoxy)-N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]acetamide
2-(2-methoxyphenoxy)-N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 1236902) has the molecular formula C22H23N3O6S2
and a molecular weight of 489.58 g/mol. Its IUPAC name is 2-(2-methoxyphenoxy)-N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]acetamide.
Molecular Properties
| Compound Name | 2-(2-methoxyphenoxy)-N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]acetamide |
| PubChem CID | 1236902 |
| Molecular Formula | C22H23N3O6S2 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | 2-(2-methoxyphenoxy)-N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | COc1ccccc1OCC(=O)Nc1nc(-c2ccc(S(=O)(=O)N3CCOCC3)cc2)cs1 |
| InChI | InChI=1S/C22H23N3O6S2/c1-29-19-4-2-3-5-20(19)31-14-21(26)24-22-23-18(15-32-22)16-6-8-17(9-7-16)33(27,28)25-10-12-30-13-11-25/h2-9,15H,10-14H2,1H3,(H,23,24,26) |
| InChIKey | ICAZZASBSTUBJI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-(2-methoxyphenoxy)-N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyphenoxy)-N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]acetamide?
The IUPAC name of 2-(2-methoxyphenoxy)-N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]acetamide (CID 1236902) is 2-(2-methoxyphenoxy)-N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]acetamide.
What is the SMILES notation for 2-(2-methoxyphenoxy)-N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]acetamide?
The canonical SMILES for 2-(2-methoxyphenoxy)-N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]acetamide is COc1ccccc1OCC(=O)Nc1nc(-c2ccc(S(=O)(=O)N3CCOCC3)cc2)cs1.
What is the InChIKey of 2-(2-methoxyphenoxy)-N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]acetamide?
The InChIKey is ICAZZASBSTUBJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N3O6S2/c1-29-19-4-2-3-5-20(19)31-14-21(26)24-22-23-18(15-32-22)16-6-8-17(9-7-16)33(27,28)25-10-12-30-13-11-25/h2-9,15H,10-14H2,1H3,(H,23,24,26).
What are the key properties of 2-(2-methoxyphenoxy)-N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]acetamide?
2-(2-methoxyphenoxy)-N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]acetamide has a molecular weight of 489.58 g/mol, XLogP of 2.86, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyphenoxy)-N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]acetamide is sourced from PubChem (CID 1236902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).