About 4-cyclopropyl-1,2-oxazole
4-cyclopropyl-1,2-oxazole (PubChem CID 123690360) has the molecular formula C6H7NO
and a molecular weight of 109.13 g/mol. Its IUPAC name is 4-cyclopropyl-1,2-oxazole.
Molecular Properties
| Compound Name | 4-cyclopropyl-1,2-oxazole |
| PubChem CID | 123690360 |
| Molecular Formula | C6H7NO |
| Molecular Weight | 109.13 g/mol |
| Exact Mass | 109.05 |
| IUPAC Name | 4-cyclopropyl-1,2-oxazole |
| SMILES | c1nocc1C1CC1 |
| InChI | InChI=1S/C6H7NO/c1-2-5(1)6-3-7-8-4-6/h3-5H,1-2H2 |
| InChIKey | JCCGLKHVKZIZTO-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.13 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyclopropyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-1,2-oxazole?
The IUPAC name of 4-cyclopropyl-1,2-oxazole (CID 123690360) is 4-cyclopropyl-1,2-oxazole.
What is the SMILES notation for 4-cyclopropyl-1,2-oxazole?
The canonical SMILES for 4-cyclopropyl-1,2-oxazole is c1nocc1C1CC1.
What is the InChIKey of 4-cyclopropyl-1,2-oxazole?
The InChIKey is JCCGLKHVKZIZTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO/c1-2-5(1)6-3-7-8-4-6/h3-5H,1-2H2.
What are the key properties of 4-cyclopropyl-1,2-oxazole?
4-cyclopropyl-1,2-oxazole has a molecular weight of 109.13 g/mol, XLogP of 1.55, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-1,2-oxazole is sourced from PubChem (CID 123690360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).