C31H28ClFN6O2+2 — CID 123690670
N-[2-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxyethyl]-1,10-dimethyl-1,10-phenanthroline-1,10-diium-5-amine (PubChem CID 123690670) has the molecular formula C31H28ClFN6O2+2 and a molecular weight of 571.06 g/mol. Its IUPAC name is N-[2-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxyethyl]-1,10-dimethyl-1,10-phenanthroline-1,10-diium-5-amine.
| Compound Name | N-[2-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxyethyl]-1,10-dimethyl-1,10-phenanthroline-1,10-diium-5-amine |
|---|---|
| PubChem CID | 123690670 |
| Molecular Formula | C31H28ClFN6O2+2 |
| Molecular Weight | 571.06 g/mol |
| Exact Mass | 570.19 |
| IUPAC Name | N-[2-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxyethyl]-1,10-dimethyl-1,10-phenanthroline-1,10-diium-5-amine |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1OCCNc1cc2ccc[n+](C)c2c2c1ccc[n+]2C |
| InChI | InChI=1S/C31H27ClFN6O2/c1-38-11-4-6-19-14-25(21-7-5-12-39(2)30(21)29(19)38)34-10-13-41-28-16-22-26(17-27(28)40-3)35-18-36-31(22)37-20-8-9-24(33)23(32)15-20/h4-9,11-12,14-18H,10,13H2,1-3H3,(H,35,36,37)/q+1/p+1 |
| InChIKey | IXIPNVCQQKVYCQ-UHFFFAOYSA-O |
| XLogP | 5.62 |
| TPSA | 76.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.06 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|