About 4,6-dimethyl-3-propan-2-yltricyclo[4.1.1.12,4]nonane
4,6-dimethyl-3-propan-2-yltricyclo[4.1.1.12,4]nonane (PubChem CID 123690963) has the molecular formula C14H24
and a molecular weight of 192.35 g/mol. Its IUPAC name is 4,6-dimethyl-3-propan-2-yltricyclo[4.1.1.12,4]nonane.
Molecular Properties
| Compound Name | 4,6-dimethyl-3-propan-2-yltricyclo[4.1.1.12,4]nonane |
| PubChem CID | 123690963 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 4,6-dimethyl-3-propan-2-yltricyclo[4.1.1.12,4]nonane |
| SMILES | CC(C)C1C2CC1(C)CC1(C)CC2C1 |
| InChI | InChI=1S/C14H24/c1-9(2)12-11-7-14(12,4)8-13(3)5-10(11)6-13/h9-12H,5-8H2,1-4H3 |
| InChIKey | GCQQARQRKRQUFS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4,6-dimethyl-3-propan-2-yltricyclo[4.1.1.12,4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-3-propan-2-yltricyclo[4.1.1.12,4]nonane?
The IUPAC name of 4,6-dimethyl-3-propan-2-yltricyclo[4.1.1.12,4]nonane (CID 123690963) is 4,6-dimethyl-3-propan-2-yltricyclo[4.1.1.12,4]nonane.
What is the SMILES notation for 4,6-dimethyl-3-propan-2-yltricyclo[4.1.1.12,4]nonane?
The canonical SMILES for 4,6-dimethyl-3-propan-2-yltricyclo[4.1.1.12,4]nonane is CC(C)C1C2CC1(C)CC1(C)CC2C1.
What is the InChIKey of 4,6-dimethyl-3-propan-2-yltricyclo[4.1.1.12,4]nonane?
The InChIKey is GCQQARQRKRQUFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24/c1-9(2)12-11-7-14(12,4)8-13(3)5-10(11)6-13/h9-12H,5-8H2,1-4H3.
What are the key properties of 4,6-dimethyl-3-propan-2-yltricyclo[4.1.1.12,4]nonane?
4,6-dimethyl-3-propan-2-yltricyclo[4.1.1.12,4]nonane has a molecular weight of 192.35 g/mol, XLogP of 4.10, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-3-propan-2-yltricyclo[4.1.1.12,4]nonane is sourced from PubChem (CID 123690963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).