About 1-methoxy-2-methylidenehexa-3,5-dien-1-ol
1-methoxy-2-methylidenehexa-3,5-dien-1-ol (PubChem CID 123691440) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is 1-methoxy-2-methylidenehexa-3,5-dien-1-ol.
Molecular Properties
| Compound Name | 1-methoxy-2-methylidenehexa-3,5-dien-1-ol |
| PubChem CID | 123691440 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 1-methoxy-2-methylidenehexa-3,5-dien-1-ol |
| SMILES | C=CC=CC(=C)C(O)OC |
| InChI | InChI=1S/C8H12O2/c1-4-5-6-7(2)8(9)10-3/h4-6,8-9H,1-2H2,3H3 |
| InChIKey | PZWUYTBOQADWAZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-2-methylidenehexa-3,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-2-methylidenehexa-3,5-dien-1-ol?
The IUPAC name of 1-methoxy-2-methylidenehexa-3,5-dien-1-ol (CID 123691440) is 1-methoxy-2-methylidenehexa-3,5-dien-1-ol.
What is the SMILES notation for 1-methoxy-2-methylidenehexa-3,5-dien-1-ol?
The canonical SMILES for 1-methoxy-2-methylidenehexa-3,5-dien-1-ol is C=CC=CC(=C)C(O)OC.
What is the InChIKey of 1-methoxy-2-methylidenehexa-3,5-dien-1-ol?
The InChIKey is PZWUYTBOQADWAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2/c1-4-5-6-7(2)8(9)10-3/h4-6,8-9H,1-2H2,3H3.
What are the key properties of 1-methoxy-2-methylidenehexa-3,5-dien-1-ol?
1-methoxy-2-methylidenehexa-3,5-dien-1-ol has a molecular weight of 140.18 g/mol, XLogP of 1.25, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2-methylidenehexa-3,5-dien-1-ol is sourced from PubChem (CID 123691440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).