C27H27BF2N2O5S — CID 123691605
3-(3,5-difluoro-2-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine (PubChem CID 123691605) has the molecular formula C27H27BF2N2O5S and a molecular weight of 540.40 g/mol. Its IUPAC name is 3-(3,5-difluoro-2-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine.
| Compound Name | 3-(3,5-difluoro-2-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 123691605 |
| Molecular Formula | C27H27BF2N2O5S |
| Molecular Weight | 540.40 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | 3-(3,5-difluoro-2-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine |
| SMILES | COc1c(F)cc(F)cc1-c1cn(S(=O)(=O)c2ccc(C)cc2)c2ncc(B3OC(C)(C)C(C)(C)O3)cc12 |
| InChI | InChI=1S/C27H27BF2N2O5S/c1-16-7-9-19(10-8-16)38(33,34)32-15-22(20-12-18(29)13-23(30)24(20)35-6)21-11-17(14-31-25(21)32)28-36-26(2,3)27(4,5)37-28/h7-15H,1-6H3 |
| InChIKey | JRIGKLZKPCNHIL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.40 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|