C16H16ClF6N5 — CID 123691903
3-chloro-8-methyl-6-(2,2,2-trifluoroethyl)-5-(3,3,3-trifluoropropyl)-8,9-dihydro-6H-[1,3]diazepino[1,2-f]pteridine (PubChem CID 123691903) has the molecular formula C16H16ClF6N5 and a molecular weight of 427.78 g/mol. Its IUPAC name is 3-chloro-8-methyl-6-(2,2,2-trifluoroethyl)-5-(3,3,3-trifluoropropyl)-8,9-dihydro-6H-[1,3]diazepino[1,2-f]pteridine.
| Compound Name | 3-chloro-8-methyl-6-(2,2,2-trifluoroethyl)-5-(3,3,3-trifluoropropyl)-8,9-dihydro-6H-[1,3]diazepino[1,2-f]pteridine |
|---|---|
| PubChem CID | 123691903 |
| Molecular Formula | C16H16ClF6N5 |
| Molecular Weight | 427.78 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 3-chloro-8-methyl-6-(2,2,2-trifluoroethyl)-5-(3,3,3-trifluoropropyl)-8,9-dihydro-6H-[1,3]diazepino[1,2-f]pteridine |
| SMILES | CC1CC=CN2C(=N1)C(CC(F)(F)F)N(CCC(F)(F)F)c1nc(Cl)ncc12 |
| InChI | InChI=1S/C16H16ClF6N5/c1-9-3-2-5-27-11-8-24-14(17)26-13(11)28(6-4-15(18,19)20)10(12(27)25-9)7-16(21,22)23/h2,5,8-10H,3-4,6-7H2,1H3 |
| InChIKey | VBLPYUASBDDNQN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 44.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.78 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |