C18H26F3NO4S — CID 123692474
methyl 3-(tert-butylsulfinylamino)-3-[4-(4,4,4-trifluorobutoxy)phenyl]propanoate (PubChem CID 123692474) has the molecular formula C18H26F3NO4S and a molecular weight of 409.47 g/mol. Its IUPAC name is methyl 3-(tert-butylsulfinylamino)-3-[4-(4,4,4-trifluorobutoxy)phenyl]propanoate.
| Compound Name | methyl 3-(tert-butylsulfinylamino)-3-[4-(4,4,4-trifluorobutoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 123692474 |
| Molecular Formula | C18H26F3NO4S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | methyl 3-(tert-butylsulfinylamino)-3-[4-(4,4,4-trifluorobutoxy)phenyl]propanoate |
| SMILES | COC(=O)CC(NS(=O)C(C)(C)C)c1ccc(OCCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H26F3NO4S/c1-17(2,3)27(24)22-15(12-16(23)25-4)13-6-8-14(9-7-13)26-11-5-10-18(19,20)21/h6-9,15,22H,5,10-12H2,1-4H3 |
| InChIKey | GIEUBTZFUUHPDO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|