About 4-methyl-3-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid
4-methyl-3-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 123692753) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-methyl-3-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-methyl-3-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid |
| PubChem CID | 123692753 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 4-methyl-3-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | CC(C)C1C=C(C(=O)O)C=CC1C |
| InChI | InChI=1S/C11H16O2/c1-7(2)10-6-9(11(12)13)5-4-8(10)3/h4-8,10H,1-3H3,(H,12,13) |
| InChIKey | AKTJGQQGGUMXAU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methyl-3-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid?
The IUPAC name of 4-methyl-3-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid (CID 123692753) is 4-methyl-3-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid.
What is the SMILES notation for 4-methyl-3-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid?
The canonical SMILES for 4-methyl-3-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid is CC(C)C1C=C(C(=O)O)C=CC1C.
What is the InChIKey of 4-methyl-3-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid?
The InChIKey is AKTJGQQGGUMXAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-7(2)10-6-9(11(12)13)5-4-8(10)3/h4-8,10H,1-3H3,(H,12,13).
What are the key properties of 4-methyl-3-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid?
4-methyl-3-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid has a molecular weight of 180.25 g/mol, XLogP of 2.48, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid is sourced from PubChem (CID 123692753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).