C19H32O4 — CID 123692778
(3-ethyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl) 2,3-dimethyl-2-propylpentanoate (PubChem CID 123692778) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is (3-ethyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl) 2,3-dimethyl-2-propylpentanoate.
| Compound Name | (3-ethyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl) 2,3-dimethyl-2-propylpentanoate |
|---|---|
| PubChem CID | 123692778 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | (3-ethyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl) 2,3-dimethyl-2-propylpentanoate |
| SMILES | CCCC(C)(C(=O)OC1CCC2C(CC)C(=O)OC12)C(C)CC |
| InChI | InChI=1S/C19H32O4/c1-6-11-19(5,12(4)7-2)18(21)22-15-10-9-14-13(8-3)17(20)23-16(14)15/h12-16H,6-11H2,1-5H3 |
| InChIKey | JRZNTNJDNWVSHK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |