C21H48OSi2 — CID 123692781
[2-(2,2-dimethylbutyl)-3,4,5,5-tetramethylhexyl]-dimethyl-trimethylsilyloxysilane (PubChem CID 123692781) has the molecular formula C21H48OSi2 and a molecular weight of 372.79 g/mol. Its IUPAC name is [2-(2,2-dimethylbutyl)-3,4,5,5-tetramethylhexyl]-dimethyl-trimethylsilyloxysilane.
| Compound Name | [2-(2,2-dimethylbutyl)-3,4,5,5-tetramethylhexyl]-dimethyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 123692781 |
| Molecular Formula | C21H48OSi2 |
| Molecular Weight | 372.79 g/mol |
| Exact Mass | 372.32 |
| IUPAC Name | [2-(2,2-dimethylbutyl)-3,4,5,5-tetramethylhexyl]-dimethyl-trimethylsilyloxysilane |
| SMILES | CCC(C)(C)CC(C[Si](C)(C)O[Si](C)(C)C)C(C)C(C)C(C)(C)C |
| InChI | InChI=1S/C21H48OSi2/c1-14-21(7,8)15-19(17(2)18(3)20(4,5)6)16-24(12,13)22-23(9,10)11/h17-19H,14-16H2,1-13H3 |
| InChIKey | FJGYLHOGOCKOJK-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.79 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|