C13H10N4O — CID 123693209
1,5-di(pyrazin-2-yl)penta-1,4-dien-3-one (PubChem CID 123693209) has the molecular formula C13H10N4O and a molecular weight of 238.25 g/mol. Its IUPAC name is 1,5-di(pyrazin-2-yl)penta-1,4-dien-3-one.
| Compound Name | 1,5-di(pyrazin-2-yl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 123693209 |
| Molecular Formula | C13H10N4O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 1,5-di(pyrazin-2-yl)penta-1,4-dien-3-one |
| SMILES | O=C(C=Cc1cnccn1)C=Cc1cnccn1 |
| InChI | InChI=1S/C13H10N4O/c18-13(3-1-11-9-14-5-7-16-11)4-2-12-10-15-6-8-17-12/h1-10H |
| InChIKey | YHHJXBWDTGVTGW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 68.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|