About [11,13-dioxo-13-[(2-oxooxolan-3-yl)amino]tridecyl]carbamic acid
[11,13-dioxo-13-[(2-oxooxolan-3-yl)amino]tridecyl]carbamic acid (PubChem CID 123693906) has the molecular formula C18H30N2O6
and a molecular weight of 370.45 g/mol. Its IUPAC name is [11,13-dioxo-13-[(2-oxooxolan-3-yl)amino]tridecyl]carbamic acid.
Molecular Properties
| Compound Name | [11,13-dioxo-13-[(2-oxooxolan-3-yl)amino]tridecyl]carbamic acid |
| PubChem CID | 123693906 |
| Molecular Formula | C18H30N2O6 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | [11,13-dioxo-13-[(2-oxooxolan-3-yl)amino]tridecyl]carbamic acid |
| SMILES | O=C(CCCCCCCCCCNC(=O)O)CC(=O)NC1CCOC1=O |
| InChI | InChI=1S/C18H30N2O6/c21-14(13-16(22)20-15-10-12-26-17(15)23)9-7-5-3-1-2-4-6-8-11-19-18(24)25/h15,19H,1-13H2,(H,20,22)(H,24,25) |
| InChIKey | XRLZGFWBFWCREQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze [11,13-dioxo-13-[(2-oxooxolan-3-yl)amino]tridecyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [11,13-dioxo-13-[(2-oxooxolan-3-yl)amino]tridecyl]carbamic acid?
The IUPAC name of [11,13-dioxo-13-[(2-oxooxolan-3-yl)amino]tridecyl]carbamic acid (CID 123693906) is [11,13-dioxo-13-[(2-oxooxolan-3-yl)amino]tridecyl]carbamic acid.
What is the SMILES notation for [11,13-dioxo-13-[(2-oxooxolan-3-yl)amino]tridecyl]carbamic acid?
The canonical SMILES for [11,13-dioxo-13-[(2-oxooxolan-3-yl)amino]tridecyl]carbamic acid is O=C(CCCCCCCCCCNC(=O)O)CC(=O)NC1CCOC1=O.
What is the InChIKey of [11,13-dioxo-13-[(2-oxooxolan-3-yl)amino]tridecyl]carbamic acid?
The InChIKey is XRLZGFWBFWCREQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N2O6/c21-14(13-16(22)20-15-10-12-26-17(15)23)9-7-5-3-1-2-4-6-8-11-19-18(24)25/h15,19H,1-13H2,(H,20,22)(H,24,25).
What are the key properties of [11,13-dioxo-13-[(2-oxooxolan-3-yl)amino]tridecyl]carbamic acid?
[11,13-dioxo-13-[(2-oxooxolan-3-yl)amino]tridecyl]carbamic acid has a molecular weight of 370.45 g/mol, XLogP of 2.16, 14 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [11,13-dioxo-13-[(2-oxooxolan-3-yl)amino]tridecyl]carbamic acid is sourced from PubChem (CID 123693906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).