C14H22N4O — CID 123694030
2-methyl-4-[4-(oxan-4-yl)piperazin-1-yl]pyrimidine (PubChem CID 123694030) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-methyl-4-[4-(oxan-4-yl)piperazin-1-yl]pyrimidine.
| Compound Name | 2-methyl-4-[4-(oxan-4-yl)piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 123694030 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 2-methyl-4-[4-(oxan-4-yl)piperazin-1-yl]pyrimidine |
| SMILES | Cc1nccc(N2CCN(C3CCOCC3)CC2)n1 |
| InChI | InChI=1S/C14H22N4O/c1-12-15-5-2-14(16-12)18-8-6-17(7-9-18)13-3-10-19-11-4-13/h2,5,13H,3-4,6-11H2,1H3 |
| InChIKey | XIEQJINXKGQNMD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |