About N-butyl-4-[(2,3-dimethylbut-2-enoylamino)methyl]oxane-4-carboxamide
N-butyl-4-[(2,3-dimethylbut-2-enoylamino)methyl]oxane-4-carboxamide (PubChem CID 123694173) has the molecular formula C17H30N2O3
and a molecular weight of 310.44 g/mol. Its IUPAC name is N-butyl-4-[(2,3-dimethylbut-2-enoylamino)methyl]oxane-4-carboxamide.
Molecular Properties
| Compound Name | N-butyl-4-[(2,3-dimethylbut-2-enoylamino)methyl]oxane-4-carboxamide |
| PubChem CID | 123694173 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | N-butyl-4-[(2,3-dimethylbut-2-enoylamino)methyl]oxane-4-carboxamide |
| SMILES | CCCCNC(=O)C1(CNC(=O)C(C)=C(C)C)CCOCC1 |
| InChI | InChI=1S/C17H30N2O3/c1-5-6-9-18-16(21)17(7-10-22-11-8-17)12-19-15(20)14(4)13(2)3/h5-12H2,1-4H3,(H,18,21)(H,19,20) |
| InChIKey | AVQGUWCINRERJN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-4-[(2,3-dimethylbut-2-enoylamino)methyl]oxane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-4-[(2,3-dimethylbut-2-enoylamino)methyl]oxane-4-carboxamide?
The IUPAC name of N-butyl-4-[(2,3-dimethylbut-2-enoylamino)methyl]oxane-4-carboxamide (CID 123694173) is N-butyl-4-[(2,3-dimethylbut-2-enoylamino)methyl]oxane-4-carboxamide.
What is the SMILES notation for N-butyl-4-[(2,3-dimethylbut-2-enoylamino)methyl]oxane-4-carboxamide?
The canonical SMILES for N-butyl-4-[(2,3-dimethylbut-2-enoylamino)methyl]oxane-4-carboxamide is CCCCNC(=O)C1(CNC(=O)C(C)=C(C)C)CCOCC1.
What is the InChIKey of N-butyl-4-[(2,3-dimethylbut-2-enoylamino)methyl]oxane-4-carboxamide?
The InChIKey is AVQGUWCINRERJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N2O3/c1-5-6-9-18-16(21)17(7-10-22-11-8-17)12-19-15(20)14(4)13(2)3/h5-12H2,1-4H3,(H,18,21)(H,19,20).
What are the key properties of N-butyl-4-[(2,3-dimethylbut-2-enoylamino)methyl]oxane-4-carboxamide?
N-butyl-4-[(2,3-dimethylbut-2-enoylamino)methyl]oxane-4-carboxamide has a molecular weight of 310.44 g/mol, XLogP of 2.17, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-4-[(2,3-dimethylbut-2-enoylamino)methyl]oxane-4-carboxamide is sourced from PubChem (CID 123694173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).