C32H44O16 — CID 123694231
6-[5-[4-[3-[1-(1-carboxy-2,3,4-trihydroxybutoxy)ethoxy]-4-methoxyphenyl]-2,3-dimethylbutyl]-2-hydroxyphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 123694231) has the molecular formula C32H44O16 and a molecular weight of 684.69 g/mol. Its IUPAC name is 6-[5-[4-[3-[1-(1-carboxy-2,3,4-trihydroxybutoxy)ethoxy]-4-methoxyphenyl]-2,3-dimethylbutyl]-2-hydroxyphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[5-[4-[3-[1-(1-carboxy-2,3,4-trihydroxybutoxy)ethoxy]-4-methoxyphenyl]-2,3-dimethylbutyl]-2-hydroxyphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 123694231 |
| Molecular Formula | C32H44O16 |
| Molecular Weight | 684.69 g/mol |
| Exact Mass | 684.26 |
| IUPAC Name | 6-[5-[4-[3-[1-(1-carboxy-2,3,4-trihydroxybutoxy)ethoxy]-4-methoxyphenyl]-2,3-dimethylbutyl]-2-hydroxyphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | COc1ccc(CC(C)C(C)Cc2ccc(O)c(OC3OC(C(=O)O)C(O)C(O)C3O)c2)cc1OC(C)OC(C(=O)O)C(O)C(O)CO |
| InChI | InChI=1S/C32H44O16/c1-14(9-17-5-7-19(34)22(11-17)47-32-27(39)25(37)26(38)29(48-32)31(42)43)15(2)10-18-6-8-21(44-4)23(12-18)45-16(3)46-28(30(40)41)24(36)20(35)13-33/h5-8,11-12,14-16,20,24-29,32-39H,9-10,13H2,1-4H3,(H,40,41)(H,42,43) |
| InChIKey | VHTXFQHNLMHFGI-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 262.36 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.69 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|